C15H18ClNO4 — CID 117496459
3-amino-2-(5-chloro-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)propanoic acid (PubChem CID 117496459) has the molecular formula C15H18ClNO4 and a molecular weight of 311.77 g/mol. Its IUPAC name is 3-amino-2-(5-chloro-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)propanoic acid.
| Compound Name | 3-amino-2-(5-chloro-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)propanoic acid |
|---|---|
| PubChem CID | 117496459 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-amino-2-(5-chloro-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)propanoic acid |
| SMILES | NCC(C(=O)O)c1c2c(c(Cl)c3c1OCCC3)OCCC2 |
| InChI | InChI=1S/C15H18ClNO4/c16-12-9-4-2-5-20-13(9)11(10(7-17)15(18)19)8-3-1-6-21-14(8)12/h10H,1-7,17H2,(H,18,19) |
| InChIKey | XXBPLUJLDZKAMW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |