C15H19ClO3 — CID 117454568
2-(5-chloro-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)propan-1-ol (PubChem CID 117454568) has the molecular formula C15H19ClO3 and a molecular weight of 282.77 g/mol. Its IUPAC name is 2-(5-chloro-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)propan-1-ol.
| Compound Name | 2-(5-chloro-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)propan-1-ol |
|---|---|
| PubChem CID | 117454568 |
| Molecular Formula | C15H19ClO3 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-(5-chloro-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)propan-1-ol |
| SMILES | CC(CO)c1c2c(c(Cl)c3c1OCCC3)OCCC2 |
| InChI | InChI=1S/C15H19ClO3/c1-9(8-17)12-10-4-2-7-19-15(10)13(16)11-5-3-6-18-14(11)12/h9,17H,2-8H2,1H3 |
| InChIKey | FVZHZEQNBCTZMT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |