C15H17ClO4 — CID 115010184
3-(5-chloro-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)propanoic acid (PubChem CID 115010184) has the molecular formula C15H17ClO4 and a molecular weight of 296.75 g/mol. Its IUPAC name is 3-(5-chloro-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)propanoic acid.
| Compound Name | 3-(5-chloro-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)propanoic acid |
|---|---|
| PubChem CID | 115010184 |
| Molecular Formula | C15H17ClO4 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-(5-chloro-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)propanoic acid |
| SMILES | O=C(O)CCc1c2c(c(Cl)c3c1OCCC3)OCCC2 |
| InChI | InChI=1S/C15H17ClO4/c16-13-11-4-2-7-19-14(11)10(5-6-12(17)18)9-3-1-8-20-15(9)13/h1-8H2,(H,17,18) |
| InChIKey | PCQAOGQWYYMZKC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |