C12H9ClO5 — CID 117424996
2-(4-chloro-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)-2-oxoacetic acid (PubChem CID 117424996) has the molecular formula C12H9ClO5 and a molecular weight of 268.65 g/mol. Its IUPAC name is 2-(4-chloro-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)-2-oxoacetic acid.
| Compound Name | 2-(4-chloro-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 117424996 |
| Molecular Formula | C12H9ClO5 |
| Molecular Weight | 268.65 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-(4-chloro-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1c2c(c(Cl)c3c1OCC3)OCC2 |
| InChI | InChI=1S/C12H9ClO5/c13-8-6-2-4-17-10(6)7(9(14)12(15)16)5-1-3-18-11(5)8/h1-4H2,(H,15,16) |
| InChIKey | UGWWBRDWRPVMPV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.65 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|