C11H11ClO2S — CID 116986482
(4-chloro-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)methanethiol (PubChem CID 116986482) has the molecular formula C11H11ClO2S and a molecular weight of 242.73 g/mol. Its IUPAC name is (4-chloro-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)methanethiol.
| Compound Name | (4-chloro-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)methanethiol |
|---|---|
| PubChem CID | 116986482 |
| Molecular Formula | C11H11ClO2S |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | (4-chloro-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)methanethiol |
| SMILES | SCc1c2c(c(Cl)c3c1OCC3)OCC2 |
| InChI | InChI=1S/C11H11ClO2S/c12-9-7-2-4-13-10(7)8(5-15)6-1-3-14-11(6)9/h15H,1-5H2 |
| InChIKey | WYUMLBFBLSZWKN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|