C12H12ClNO5 — CID 117460092
3-amino-2-(6-chloro-8-formyl-2,3-dihydro-1,4-benzodioxin-5-yl)propanoic acid (PubChem CID 117460092) has the molecular formula C12H12ClNO5 and a molecular weight of 285.68 g/mol. Its IUPAC name is 3-amino-2-(6-chloro-8-formyl-2,3-dihydro-1,4-benzodioxin-5-yl)propanoic acid.
| Compound Name | 3-amino-2-(6-chloro-8-formyl-2,3-dihydro-1,4-benzodioxin-5-yl)propanoic acid |
|---|---|
| PubChem CID | 117460092 |
| Molecular Formula | C12H12ClNO5 |
| Molecular Weight | 285.68 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 3-amino-2-(6-chloro-8-formyl-2,3-dihydro-1,4-benzodioxin-5-yl)propanoic acid |
| SMILES | NCC(C(=O)O)c1c(Cl)cc(C=O)c2c1OCCO2 |
| InChI | InChI=1S/C12H12ClNO5/c13-8-3-6(5-15)10-11(19-2-1-18-10)9(8)7(4-14)12(16)17/h3,5,7H,1-2,4,14H2,(H,16,17) |
| InChIKey | RMMKIYWFMUMJHJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.68 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|