C15H18O6 — CID 117474709
2-hydroxy-2-(5-methoxy-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)acetic acid (PubChem CID 117474709) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-hydroxy-2-(5-methoxy-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)acetic acid.
| Compound Name | 2-hydroxy-2-(5-methoxy-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)acetic acid |
|---|---|
| PubChem CID | 117474709 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-hydroxy-2-(5-methoxy-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)acetic acid |
| SMILES | COc1c2c(c(C(O)C(=O)O)c3c1OCCC3)OCCC2 |
| InChI | InChI=1S/C15H18O6/c1-19-13-9-5-3-6-20-12(9)10(11(16)15(17)18)8-4-2-7-21-14(8)13/h11,16H,2-7H2,1H3,(H,17,18) |
| InChIKey | YHAGAFQGMPXGQG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |