C13H16ClNO3 — CID 117427442
2-amino-2-(4-chloro-3-hydroxy-1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)acetic acid (PubChem CID 117427442) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is 2-amino-2-(4-chloro-3-hydroxy-1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)acetic acid.
| Compound Name | 2-amino-2-(4-chloro-3-hydroxy-1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)acetic acid |
|---|---|
| PubChem CID | 117427442 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-amino-2-(4-chloro-3-hydroxy-1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)acetic acid |
| SMILES | Cc1c2c(c(Cl)c(O)c1C(N)C(=O)O)CCCC2 |
| InChI | InChI=1S/C13H16ClNO3/c1-6-7-4-2-3-5-8(7)10(14)12(16)9(6)11(15)13(17)18/h11,16H,2-5,15H2,1H3,(H,17,18) |
| InChIKey | BVHSSVAQNXJREQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|