About 3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine
3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine (PubChem CID 609172) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine.
Analyze 3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine?
The IUPAC name of 3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine (CID 609172) is 3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine.
What is the SMILES notation for 3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine?
The canonical SMILES for 3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine is c1c2c(cc3c1CCCO3)OCCCC2.
What is the InChIKey of 3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine?
The InChIKey is COUIJFFOVNSEQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-6-14-12-9-13-11(5-3-7-15-13)8-10(12)4-1/h8-9H,1-7H2.
What are the key properties of 3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine?
3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine has a molecular weight of 204.27 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,6,7,8,9-hexahydro-2H-pyrano[3,2-h][1]benzoxepine is sourced from PubChem (CID 609172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).