C11H13NO2 — CID 55272686
3,5,6,7-tetrahydro-2H-furo[3,2-g]chromen-3-amine (PubChem CID 55272686) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3,5,6,7-tetrahydro-2H-furo[3,2-g]chromen-3-amine.
| Compound Name | 3,5,6,7-tetrahydro-2H-furo[3,2-g]chromen-3-amine |
|---|---|
| PubChem CID | 55272686 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3,5,6,7-tetrahydro-2H-furo[3,2-g]chromen-3-amine |
| SMILES | NC1COc2cc3c(cc21)CCCO3 |
| InChI | InChI=1S/C11H13NO2/c12-9-6-14-11-5-10-7(4-8(9)11)2-1-3-13-10/h4-5,9H,1-3,6,12H2 |
| InChIKey | ZPZDQUTZNHZEJL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |