C11H12O3 — CID 130572441
3,6,7,8-tetrahydro-2H-furo[2,3-g]chromen-3-ol (PubChem CID 130572441) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 3,6,7,8-tetrahydro-2H-furo[2,3-g]chromen-3-ol.
| Compound Name | 3,6,7,8-tetrahydro-2H-furo[2,3-g]chromen-3-ol |
|---|---|
| PubChem CID | 130572441 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 3,6,7,8-tetrahydro-2H-furo[2,3-g]chromen-3-ol |
| SMILES | OC1COc2cc3c(cc21)OCCC3 |
| InChI | InChI=1S/C11H12O3/c12-9-6-14-11-4-7-2-1-3-13-10(7)5-8(9)11/h4-5,9,12H,1-3,6H2 |
| InChIKey | KURBUPQLBPBEEV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |