C12H14FN — CID 162394388
5-cyclopropyl-7-fluoro-2,3-dihydro-1H-inden-4-amine (PubChem CID 162394388) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is 5-cyclopropyl-7-fluoro-2,3-dihydro-1H-inden-4-amine.
| Compound Name | 5-cyclopropyl-7-fluoro-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 162394388 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 5-cyclopropyl-7-fluoro-2,3-dihydro-1H-inden-4-amine |
| SMILES | Nc1c(C2CC2)cc(F)c2c1CCC2 |
| InChI | InChI=1S/C12H14FN/c13-11-6-10(7-4-5-7)12(14)9-3-1-2-8(9)11/h6-7H,1-5,14H2 |
| InChIKey | CKUVLTXVGFFCEK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|