C12H14FN — CID 130718409
(2S)-2-(7-fluoro-2,3-dihydro-1H-inden-4-yl)azetidine (PubChem CID 130718409) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is (2S)-2-(7-fluoro-2,3-dihydro-1H-inden-4-yl)azetidine.
| Compound Name | (2S)-2-(7-fluoro-2,3-dihydro-1H-inden-4-yl)azetidine |
|---|---|
| PubChem CID | 130718409 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (2S)-2-(7-fluoro-2,3-dihydro-1H-inden-4-yl)azetidine |
| SMILES | Fc1ccc([C@@H]2CCN2)c2c1CCC2 |
| InChI | InChI=1S/C12H14FN/c13-11-5-4-10(12-6-7-14-12)8-2-1-3-9(8)11/h4-5,12,14H,1-3,6-7H2/t12-/m0/s1 |
| InChIKey | LECLTGUJHUTFIU-LBPRGKRZSA-N |
| XLogP | 2.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |