C11H12FNO — CID 130639912
(2S)-2-(4-fluoro-2,3-dihydro-1-benzofuran-7-yl)azetidine (PubChem CID 130639912) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is (2S)-2-(4-fluoro-2,3-dihydro-1-benzofuran-7-yl)azetidine.
| Compound Name | (2S)-2-(4-fluoro-2,3-dihydro-1-benzofuran-7-yl)azetidine |
|---|---|
| PubChem CID | 130639912 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (2S)-2-(4-fluoro-2,3-dihydro-1-benzofuran-7-yl)azetidine |
| SMILES | Fc1ccc([C@@H]2CCN2)c2c1CCO2 |
| InChI | InChI=1S/C11H12FNO/c12-9-2-1-8(10-3-5-13-10)11-7(9)4-6-14-11/h1-2,10,13H,3-6H2/t10-/m0/s1 |
| InChIKey | VTOQSTWCNTWREF-JTQLQIEISA-N |
| XLogP | 1.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |