C12H15NO — CID 131172256
(2R)-2-(3,4-dihydro-2H-chromen-5-yl)azetidine (PubChem CID 131172256) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (2R)-2-(3,4-dihydro-2H-chromen-5-yl)azetidine.
| Compound Name | (2R)-2-(3,4-dihydro-2H-chromen-5-yl)azetidine |
|---|---|
| PubChem CID | 131172256 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (2R)-2-(3,4-dihydro-2H-chromen-5-yl)azetidine |
| SMILES | c1cc2c(c([C@H]3CCN3)c1)CCCO2 |
| InChI | InChI=1S/C12H15NO/c1-3-9(11-6-7-13-11)10-4-2-8-14-12(10)5-1/h1,3,5,11,13H,2,4,6-8H2/t11-/m1/s1 |
| InChIKey | DEWLKBANNHVPMM-LLVKDONJSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |