3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid

C9H11NO2S — CID 82398824

IUPAC3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid
SMILESNc1c(C(=O)O)sc2c1CCCC2
InChIInChI=1S/C9H11NO2S/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4,10H2,(H,11,12)
InChIKeyFGHTVTKSIDJJIN-UHFFFAOYSA-N
MW197.26 g/mol
LogP1.91
Rot. Bonds1

About 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid

3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid (PubChem CID 82398824) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid.

Molecular Properties

Compound Name3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid
PubChem CID82398824
Molecular FormulaC9H11NO2S
Molecular Weight197.26 g/mol
Exact Mass197.05
IUPAC Name3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid
SMILESNc1c(C(=O)O)sc2c1CCCC2
InChIInChI=1S/C9H11NO2S/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4,10H2,(H,11,12)
InChIKeyFGHTVTKSIDJJIN-UHFFFAOYSA-N
XLogP1.91
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.26
LogP ≤ 51.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid?
The IUPAC name of 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid (CID 82398824) is 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid.
What is the SMILES notation for 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid?
The canonical SMILES for 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid is Nc1c(C(=O)O)sc2c1CCCC2.
What is the InChIKey of 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid?
The InChIKey is FGHTVTKSIDJJIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4,10H2,(H,11,12).
What are the key properties of 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid?
3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid has a molecular weight of 197.26 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid is sourced from PubChem (CID 82398824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).