About 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid
3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid (PubChem CID 82398824) has the molecular formula C9H11NO2S
and a molecular weight of 197.26 g/mol. Its IUPAC name is 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid.
Analyze 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid?
The IUPAC name of 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid (CID 82398824) is 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid.
What is the SMILES notation for 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid?
The canonical SMILES for 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid is Nc1c(C(=O)O)sc2c1CCCC2.
What is the InChIKey of 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid?
The InChIKey is FGHTVTKSIDJJIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4,10H2,(H,11,12).
What are the key properties of 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid?
3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid has a molecular weight of 197.26 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid is sourced from PubChem (CID 82398824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).