C12H13F3N2O4S — CID 160806481
4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 160806481) has the molecular formula C12H13F3N2O4S and a molecular weight of 338.31 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 160806481 |
| Molecular Formula | C12H13F3N2O4S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1sc2c(c1C(N)=O)CCCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H12N2O2S.C2HF3O2/c11-9(13)7-5-3-1-2-4-6(5)15-8(7)10(12)14;3-2(4,5)1(6)7/h1-4H2,(H2,11,13)(H2,12,14);(H,6,7) |
| InChIKey | SDTGXKUDEKOSGO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |