C29H31F3N4O7S — CID 69352286
2-(N-[3-(aminomethyl)benzoyl]anilino)acetic acid;3-N-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 69352286) has the molecular formula C29H31F3N4O7S and a molecular weight of 636.65 g/mol. Its IUPAC name is 2-(N-[3-(aminomethyl)benzoyl]anilino)acetic acid;3-N-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(N-[3-(aminomethyl)benzoyl]anilino)acetic acid;3-N-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69352286 |
| Molecular Formula | C29H31F3N4O7S |
| Molecular Weight | 636.65 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | 2-(N-[3-(aminomethyl)benzoyl]anilino)acetic acid;3-N-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)c1c(C(N)=O)sc2c1CCCC2.NCc1cccc(C(=O)N(CC(=O)O)c2ccccc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H16N2O3.C11H14N2O2S.C2HF3O2/c17-10-12-5-4-6-13(9-12)16(21)18(11-15(19)20)14-7-2-1-3-8-14;1-13-11(15)8-6-4-2-3-5-7(6)16-9(8)10(12)14;3-2(4,5)1(6)7/h1-9H,10-11,17H2,(H,19,20);2-5H2,1H3,(H2,12,14)(H,13,15);(H,6,7) |
| InChIKey | VVVWVCWINDFCKP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 193.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |