C27H32F3N3O4 — CID 22382665
N-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(aminomethyl)-N-phenylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 22382665) has the molecular formula C27H32F3N3O4 and a molecular weight of 519.56 g/mol. Its IUPAC name is N-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(aminomethyl)-N-phenylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(aminomethyl)-N-phenylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22382665 |
| Molecular Formula | C27H32F3N3O4 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | N-[2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(aminomethyl)-N-phenylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | NCc1cccc(C(=O)N(CC(=O)N2CCC3CCCCC3C2)c2ccccc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H31N3O2.C2HF3O2/c26-16-19-7-6-10-21(15-19)25(30)28(23-11-2-1-3-12-23)18-24(29)27-14-13-20-8-4-5-9-22(20)17-27;3-2(4,5)1(6)7/h1-3,6-7,10-12,15,20,22H,4-5,8-9,13-14,16-18,26H2;(H,6,7) |
| InChIKey | ZJYISTVFPXLXRY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |