C28H29ClF3N3O8S2 — CID 69353678
2-(N-[3-(aminomethyl)benzoyl]-2-chloroanilino)acetic acid;3-methylsulfonyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 69353678) has the molecular formula C28H29ClF3N3O8S2 and a molecular weight of 692.13 g/mol. Its IUPAC name is 2-(N-[3-(aminomethyl)benzoyl]-2-chloroanilino)acetic acid;3-methylsulfonyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(N-[3-(aminomethyl)benzoyl]-2-chloroanilino)acetic acid;3-methylsulfonyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69353678 |
| Molecular Formula | C28H29ClF3N3O8S2 |
| Molecular Weight | 692.13 g/mol |
| Exact Mass | 691.10 |
| IUPAC Name | 2-(N-[3-(aminomethyl)benzoyl]-2-chloroanilino)acetic acid;3-methylsulfonyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)c1c(C(N)=O)sc2c1CCCC2.NCc1cccc(C(=O)N(CC(=O)O)c2ccccc2Cl)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H15ClN2O3.C10H13NO3S2.C2HF3O2/c17-13-6-1-2-7-14(13)19(10-15(20)21)16(22)12-5-3-4-11(8-12)9-18;1-16(13,14)9-6-4-2-3-5-7(6)15-8(9)10(11)12;3-2(4,5)1(6)7/h1-8H,9-10,18H2,(H,20,21);2-5H2,1H3,(H2,11,12);(H,6,7) |
| InChIKey | GVEHSHLCGATHHH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 198.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.13 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |