C8H4Br2N4 — CID 121374097
4,5-diamino-3,6-dibromobenzene-1,2-dicarbonitrile (PubChem CID 121374097) has the molecular formula C8H4Br2N4 and a molecular weight of 315.96 g/mol. Its IUPAC name is 4,5-diamino-3,6-dibromobenzene-1,2-dicarbonitrile.
| Compound Name | 4,5-diamino-3,6-dibromobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 121374097 |
| Molecular Formula | C8H4Br2N4 |
| Molecular Weight | 315.96 g/mol |
| Exact Mass | 313.88 |
| IUPAC Name | 4,5-diamino-3,6-dibromobenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(Br)c(N)c(N)c(Br)c1C#N |
| InChI | InChI=1S/C8H4Br2N4/c9-5-3(1-11)4(2-12)6(10)8(14)7(5)13/h13-14H2 |
| InChIKey | FKUSUCFFYISLOF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.96 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|