C8Br2N4Se — CID 142291628
4,7-dibromo-2,1,3-benzoselenadiazole-5,6-dicarbonitrile (PubChem CID 142291628) has the molecular formula C8Br2N4Se and a molecular weight of 390.88 g/mol. Its IUPAC name is 4,7-dibromo-2,1,3-benzoselenadiazole-5,6-dicarbonitrile.
| Compound Name | 4,7-dibromo-2,1,3-benzoselenadiazole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 142291628 |
| Molecular Formula | C8Br2N4Se |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 389.77 |
| IUPAC Name | 4,7-dibromo-2,1,3-benzoselenadiazole-5,6-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c(Br)c2n[se]nc2c1Br |
| InChI | InChI=1S/C8Br2N4Se/c9-5-3(1-11)4(2-12)6(10)8-7(5)13-15-14-8 |
| InChIKey | WERACCFFGDSEII-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|