C8H4N6S — CID 134417912
4,7-diamino-2,1,3-benzothiadiazole-5,6-dicarbonitrile (PubChem CID 134417912) has the molecular formula C8H4N6S and a molecular weight of 216.23 g/mol. Its IUPAC name is 4,7-diamino-2,1,3-benzothiadiazole-5,6-dicarbonitrile.
| Compound Name | 4,7-diamino-2,1,3-benzothiadiazole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 134417912 |
| Molecular Formula | C8H4N6S |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 4,7-diamino-2,1,3-benzothiadiazole-5,6-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c(N)c2nsnc2c1N |
| InChI | InChI=1S/C8H4N6S/c9-1-3-4(2-10)6(12)8-7(5(3)11)13-15-14-8/h11-12H2 |
| InChIKey | LUHDREMIJYQDFK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|