About 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile
4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile (PubChem CID 144724874) has the molecular formula C8H4BrN3S
and a molecular weight of 254.11 g/mol. Its IUPAC name is 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile.
Molecular Properties
| Compound Name | 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile |
| PubChem CID | 144724874 |
| Molecular Formula | C8H4BrN3S |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 252.93 |
| IUPAC Name | 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile |
| SMILES | Cc1c(C#N)cc(Br)c2nsnc12 |
| InChI | InChI=1S/C8H4BrN3S/c1-4-5(3-10)2-6(9)8-7(4)11-13-12-8/h2H,1H3 |
| InChIKey | FOXMFEUEZWSABP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile?
The IUPAC name of 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile (CID 144724874) is 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile.
What is the SMILES notation for 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile?
The canonical SMILES for 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile is Cc1c(C#N)cc(Br)c2nsnc12.
What is the InChIKey of 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile?
The InChIKey is FOXMFEUEZWSABP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrN3S/c1-4-5(3-10)2-6(9)8-7(4)11-13-12-8/h2H,1H3.
What are the key properties of 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile?
4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile has a molecular weight of 254.11 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-7-methyl-2,1,3-benzothiadiazole-6-carbonitrile is sourced from PubChem (CID 144724874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).