C9H8BrN — CID 56604249
4-bromo-2,5-dimethylbenzonitrile (PubChem CID 56604249) has the molecular formula C9H8BrN and a molecular weight of 210.07 g/mol. Its IUPAC name is 4-bromo-2,5-dimethylbenzonitrile.
| Compound Name | 4-bromo-2,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 56604249 |
| Molecular Formula | C9H8BrN |
| Molecular Weight | 210.07 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | 4-bromo-2,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)c(C)cc1Br |
| InChI | InChI=1S/C9H8BrN/c1-6-4-9(10)7(2)3-8(6)5-11/h3-4H,1-2H3 |
| InChIKey | HZMQTNIFPKVBFC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.07 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |