C11H14N2 — CID 131037934
4-[(1R)-1-aminoethyl]-2,5-dimethylbenzonitrile (PubChem CID 131037934) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 4-[(1R)-1-aminoethyl]-2,5-dimethylbenzonitrile.
| Compound Name | 4-[(1R)-1-aminoethyl]-2,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 131037934 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 4-[(1R)-1-aminoethyl]-2,5-dimethylbenzonitrile |
| SMILES | Cc1cc([C@@H](C)N)c(C)cc1C#N |
| InChI | InChI=1S/C11H14N2/c1-7-5-11(9(3)13)8(2)4-10(7)6-12/h4-5,9H,13H2,1-3H3/t9-/m1/s1 |
| InChIKey | IYWYRUPFLYEYAT-SECBINFHSA-N |
| XLogP | 2.19 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |