C6N4S — CID 45121762
1,2-thiazole-3,4,5-tricarbonitrile (PubChem CID 45121762) has the molecular formula C6N4S and a molecular weight of 160.16 g/mol. Its IUPAC name is 1,2-thiazole-3,4,5-tricarbonitrile.
| Compound Name | 1,2-thiazole-3,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 45121762 |
| Molecular Formula | C6N4S |
| Molecular Weight | 160.16 g/mol |
| Exact Mass | 159.98 |
| IUPAC Name | 1,2-thiazole-3,4,5-tricarbonitrile |
| SMILES | N#Cc1nsc(C#N)c1C#N |
| InChI | InChI=1S/C6N4S/c7-1-4-5(2-8)10-11-6(4)3-9 |
| InChIKey | PPFVJJFCZQQCOQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |