About 1,2-thiazole-3,4,5-tricarbonitrile
1,2-thiazole-3,4,5-tricarbonitrile (PubChem CID 45121762) has the molecular formula C6N4S
and a molecular weight of 160.16 g/mol. Its IUPAC name is 1,2-thiazole-3,4,5-tricarbonitrile.
Molecular Properties
| Compound Name | 1,2-thiazole-3,4,5-tricarbonitrile |
| PubChem CID | 45121762 |
| Molecular Formula | C6N4S |
| Molecular Weight | 160.16 g/mol |
| Exact Mass | 159.98 |
| IUPAC Name | 1,2-thiazole-3,4,5-tricarbonitrile |
| SMILES | N#Cc1nsc(C#N)c1C#N |
| InChI | InChI=1S/C6N4S/c7-1-4-5(2-8)10-11-6(4)3-9 |
| InChIKey | PPFVJJFCZQQCOQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2-thiazole-3,4,5-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-thiazole-3,4,5-tricarbonitrile?
The IUPAC name of 1,2-thiazole-3,4,5-tricarbonitrile (CID 45121762) is 1,2-thiazole-3,4,5-tricarbonitrile.
What is the SMILES notation for 1,2-thiazole-3,4,5-tricarbonitrile?
The canonical SMILES for 1,2-thiazole-3,4,5-tricarbonitrile is N#Cc1nsc(C#N)c1C#N.
What is the InChIKey of 1,2-thiazole-3,4,5-tricarbonitrile?
The InChIKey is PPFVJJFCZQQCOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6N4S/c7-1-4-5(2-8)10-11-6(4)3-9.
What are the key properties of 1,2-thiazole-3,4,5-tricarbonitrile?
1,2-thiazole-3,4,5-tricarbonitrile has a molecular weight of 160.16 g/mol, XLogP of 0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-thiazole-3,4,5-tricarbonitrile is sourced from PubChem (CID 45121762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).