C4Cl2N2S — CID 82654019
4,5-dichloro-1,2-thiazole-3-carbonitrile (PubChem CID 82654019) has the molecular formula C4Cl2N2S and a molecular weight of 179.03 g/mol. Its IUPAC name is 4,5-dichloro-1,2-thiazole-3-carbonitrile.
| Compound Name | 4,5-dichloro-1,2-thiazole-3-carbonitrile |
|---|---|
| PubChem CID | 82654019 |
| Molecular Formula | C4Cl2N2S |
| Molecular Weight | 179.03 g/mol |
| Exact Mass | 177.92 |
| IUPAC Name | 4,5-dichloro-1,2-thiazole-3-carbonitrile |
| SMILES | N#Cc1nsc(Cl)c1Cl |
| InChI | InChI=1S/C4Cl2N2S/c5-3-2(1-7)8-9-4(3)6 |
| InChIKey | PIUHKOXJYRSVNO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.03 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |