C6Cl3FN2 — CID 88709704
3,5,6-trichloro-4-fluoropyridine-2-carbonitrile (PubChem CID 88709704) has the molecular formula C6Cl3FN2 and a molecular weight of 225.44 g/mol. Its IUPAC name is 3,5,6-trichloro-4-fluoropyridine-2-carbonitrile.
| Compound Name | 3,5,6-trichloro-4-fluoropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 88709704 |
| Molecular Formula | C6Cl3FN2 |
| Molecular Weight | 225.44 g/mol |
| Exact Mass | 223.91 |
| IUPAC Name | 3,5,6-trichloro-4-fluoropyridine-2-carbonitrile |
| SMILES | N#Cc1nc(Cl)c(Cl)c(F)c1Cl |
| InChI | InChI=1S/C6Cl3FN2/c7-3-2(1-11)12-6(9)4(8)5(3)10 |
| InChIKey | SOQXEJPXHQDEIJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|