C6HCl3N2O — CID 130365828
4,5,6-trichloro-3-hydroxypyridine-2-carbonitrile (PubChem CID 130365828) has the molecular formula C6HCl3N2O and a molecular weight of 223.45 g/mol. Its IUPAC name is 4,5,6-trichloro-3-hydroxypyridine-2-carbonitrile.
| Compound Name | 4,5,6-trichloro-3-hydroxypyridine-2-carbonitrile |
|---|---|
| PubChem CID | 130365828 |
| Molecular Formula | C6HCl3N2O |
| Molecular Weight | 223.45 g/mol |
| Exact Mass | 221.92 |
| IUPAC Name | 4,5,6-trichloro-3-hydroxypyridine-2-carbonitrile |
| SMILES | N#Cc1nc(Cl)c(Cl)c(Cl)c1O |
| InChI | InChI=1S/C6HCl3N2O/c7-3-4(8)6(9)11-2(1-10)5(3)12/h12H |
| InChIKey | VRCKLLBEKVQGRL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|