C12Cl8N4 — CID 141345304
3,4,5,6-tetrachloropyridine-2-carbonitrile (PubChem CID 141345304) has the molecular formula C12Cl8N4 and a molecular weight of 483.78 g/mol. Its IUPAC name is 3,4,5,6-tetrachloropyridine-2-carbonitrile.
| Compound Name | 3,4,5,6-tetrachloropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 141345304 |
| Molecular Formula | C12Cl8N4 |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 479.76 |
| IUPAC Name | 3,4,5,6-tetrachloropyridine-2-carbonitrile |
| SMILES | N#Cc1nc(Cl)c(Cl)c(Cl)c1Cl.N#Cc1nc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/2C6Cl4N2/c2*7-3-2(1-11)12-6(10)5(9)4(3)8 |
| InChIKey | AESQCVBDDDJMAY-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|