About 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile
3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile (PubChem CID 86647969) has the molecular formula C7H4ClN3O
and a molecular weight of 181.58 g/mol. Its IUPAC name is 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile |
| PubChem CID | 86647969 |
| Molecular Formula | C7H4ClN3O |
| Molecular Weight | 181.58 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile |
| SMILES | N#Cc1nc(CC=O)cnc1Cl |
| InChI | InChI=1S/C7H4ClN3O/c8-7-6(3-9)11-5(1-2-12)4-10-7/h2,4H,1H2 |
| InChIKey | PIKWFYBGGRMAIF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 66.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.58 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile?
The IUPAC name of 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile (CID 86647969) is 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile.
What is the SMILES notation for 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile?
The canonical SMILES for 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile is N#Cc1nc(CC=O)cnc1Cl.
What is the InChIKey of 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile?
The InChIKey is PIKWFYBGGRMAIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN3O/c8-7-6(3-9)11-5(1-2-12)4-10-7/h2,4H,1H2.
What are the key properties of 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile?
3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile has a molecular weight of 181.58 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-(2-oxoethyl)pyrazine-2-carbonitrile is sourced from PubChem (CID 86647969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).