C5H4N6 — CID 55289853
1,5-diaminopyrazole-3,4-dicarbonitrile (PubChem CID 55289853) has the molecular formula C5H4N6 and a molecular weight of 148.13 g/mol. Its IUPAC name is 1,5-diaminopyrazole-3,4-dicarbonitrile.
| Compound Name | 1,5-diaminopyrazole-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 55289853 |
| Molecular Formula | C5H4N6 |
| Molecular Weight | 148.13 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 1,5-diaminopyrazole-3,4-dicarbonitrile |
| SMILES | N#Cc1nn(N)c(N)c1C#N |
| InChI | InChI=1S/C5H4N6/c6-1-3-4(2-7)10-11(9)5(3)8/h8-9H2 |
| InChIKey | NHEVBXVLKXNRMC-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.13 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |