C18N12 — CID 70451316
3,4,9,10,15,16-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene-5,6,11,12,17,18-hexacarbonitrile (PubChem CID 70451316) has the molecular formula C18N12 and a molecular weight of 384.28 g/mol. Its IUPAC name is 3,4,9,10,15,16-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene-5,6,11,12,17,18-hexacarbonitrile.
| Compound Name | 3,4,9,10,15,16-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene-5,6,11,12,17,18-hexacarbonitrile |
|---|---|
| PubChem CID | 70451316 |
| Molecular Formula | C18N12 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 3,4,9,10,15,16-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene-5,6,11,12,17,18-hexacarbonitrile |
| SMILES | N#Cc1nnc2c(c1C#N)c1nnc(C#N)c(C#N)c1c1nnc(C#N)c(C#N)c21 |
| InChI | InChI=1S/C18N12/c19-1-7-10(4-22)25-28-16-13(7)17-15(8(2-20)11(5-23)26-29-17)18-14(16)9(3-21)12(6-24)27-30-18 |
| InChIKey | RDZDAAYMKCTZCX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 220.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|