C16H6N6 — CID 54021569
phenanthro[9,10-e]tetrazine-5,6-dicarbonitrile (PubChem CID 54021569) has the molecular formula C16H6N6 and a molecular weight of 282.27 g/mol. Its IUPAC name is phenanthro[9,10-e]tetrazine-5,6-dicarbonitrile.
| Compound Name | phenanthro[9,10-e]tetrazine-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 54021569 |
| Molecular Formula | C16H6N6 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | phenanthro[9,10-e]tetrazine-5,6-dicarbonitrile |
| SMILES | N#Cc1ccc2c3ccccc3c3nnnnc3c2c1C#N |
| InChI | InChI=1S/C16H6N6/c17-7-9-5-6-11-10-3-1-2-4-12(10)15-16(20-22-21-19-15)14(11)13(9)8-18/h1-6H |
| InChIKey | KZGUKHKALVLXHX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 99.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|