C27H11N5 — CID 175298754
perylene-1,2,3,4-tetracarbonitrile;prop-2-enenitrile (PubChem CID 175298754) has the molecular formula C27H11N5 and a molecular weight of 405.42 g/mol. Its IUPAC name is perylene-1,2,3,4-tetracarbonitrile;prop-2-enenitrile.
| Compound Name | perylene-1,2,3,4-tetracarbonitrile;prop-2-enenitrile |
|---|---|
| PubChem CID | 175298754 |
| Molecular Formula | C27H11N5 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | perylene-1,2,3,4-tetracarbonitrile;prop-2-enenitrile |
| SMILES | C=CC#N.N#Cc1c(C#N)c2c(C#N)ccc3c4cccc5cccc(c(c1C#N)c23)c54 |
| InChI | InChI=1S/C24H8N4.C3H3N/c25-9-14-7-8-16-15-5-1-3-13-4-2-6-17(21(13)15)23-20(12-28)18(10-26)19(11-27)22(14)24(16)23;1-2-3-4/h1-8H;2H,1H2 |
| InChIKey | XFDALLYVROXOMI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 118.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|