C28H8N6 — CID 139436174
pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8(13),9,11,15,17,19,21-undecaene-3,4,5,6,10,11-hexacarbonitrile (PubChem CID 139436174) has the molecular formula C28H8N6 and a molecular weight of 428.41 g/mol. Its IUPAC name is pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8(13),9,11,15,17,19,21-undecaene-3,4,5,6,10,11-hexacarbonitrile.
| Compound Name | pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8(13),9,11,15,17,19,21-undecaene-3,4,5,6,10,11-hexacarbonitrile |
|---|---|
| PubChem CID | 139436174 |
| Molecular Formula | C28H8N6 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8(13),9,11,15,17,19,21-undecaene-3,4,5,6,10,11-hexacarbonitrile |
| SMILES | N#Cc1cc2c(cc1C#N)c1c3ccccc3ccc1c1c(C#N)c(C#N)c(C#N)c(C#N)c21 |
| InChI | InChI=1S/C28H8N6/c29-9-16-7-20-21(8-17(16)10-30)28-25(14-34)23(12-32)22(11-31)24(13-33)27(28)19-6-5-15-3-1-2-4-18(15)26(19)20/h1-8H |
| InChIKey | PTGUXQVVPKYPNW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|