C5H2N2O2 — CID 142659151
2-amino-3,4-dioxocyclobutene-1-carbonitrile (PubChem CID 142659151) has the molecular formula C5H2N2O2 and a molecular weight of 122.08 g/mol. Its IUPAC name is 2-amino-3,4-dioxocyclobutene-1-carbonitrile.
| Compound Name | 2-amino-3,4-dioxocyclobutene-1-carbonitrile |
|---|---|
| PubChem CID | 142659151 |
| Molecular Formula | C5H2N2O2 |
| Molecular Weight | 122.08 g/mol |
| Exact Mass | 122.01 |
| IUPAC Name | 2-amino-3,4-dioxocyclobutene-1-carbonitrile |
| SMILES | N#Cc1c(N)c(=O)c1=O |
| InChI | InChI=1S/C5H2N2O2/c6-1-2-3(7)5(9)4(2)8/h7H2 |
| InChIKey | MMDGFSKABFRERS-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.08 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|