C21H10N2O2 — CID 134975220
5-amino-7,12-dioxoindeno[1,2-a]fluorene-6-carbonitrile (PubChem CID 134975220) has the molecular formula C21H10N2O2 and a molecular weight of 322.32 g/mol. Its IUPAC name is 5-amino-7,12-dioxoindeno[1,2-a]fluorene-6-carbonitrile.
| Compound Name | 5-amino-7,12-dioxoindeno[1,2-a]fluorene-6-carbonitrile |
|---|---|
| PubChem CID | 134975220 |
| Molecular Formula | C21H10N2O2 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 5-amino-7,12-dioxoindeno[1,2-a]fluorene-6-carbonitrile |
| SMILES | N#Cc1c(N)c2c3ccccc3c(=O)c2c2c1c(=O)c1ccccc12 |
| InChI | InChI=1S/C21H10N2O2/c22-9-14-17-15(10-5-1-3-7-12(10)20(17)24)18-16(19(14)23)11-6-2-4-8-13(11)21(18)25/h1-8H,23H2 |
| InChIKey | MHOMHVDQHWHBQB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|