C30H12N2O2 — CID 20603464
2-(18,27-dioxo-9-heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaenylidene)propanedinitrile (PubChem CID 20603464) has the molecular formula C30H12N2O2 and a molecular weight of 432.44 g/mol. Its IUPAC name is 2-(18,27-dioxo-9-heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaenylidene)propanedinitrile.
| Compound Name | 2-(18,27-dioxo-9-heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaenylidene)propanedinitrile |
|---|---|
| PubChem CID | 20603464 |
| Molecular Formula | C30H12N2O2 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 2-(18,27-dioxo-9-heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaenylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C1c2ccccc2-c2c1c1c3ccccc3c(=O)c1c1c2c(=O)c2ccccc21 |
| InChI | InChI=1S/C30H12N2O2/c31-13-15(14-32)22-16-7-1-2-8-17(16)23-26(22)24-18-9-3-5-11-20(18)29(33)28(24)25-19-10-4-6-12-21(19)30(34)27(23)25/h1-12H |
| InChIKey | IEVRTKSHRCJETB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|