C15H6N4S — CID 102383190
2-(2-amino-1-cyanoindeno[2,1-b]thiophen-4-ylidene)propanedinitrile (PubChem CID 102383190) has the molecular formula C15H6N4S and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-(2-amino-1-cyanoindeno[2,1-b]thiophen-4-ylidene)propanedinitrile.
| Compound Name | 2-(2-amino-1-cyanoindeno[2,1-b]thiophen-4-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 102383190 |
| Molecular Formula | C15H6N4S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 2-(2-amino-1-cyanoindeno[2,1-b]thiophen-4-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C1c2ccccc2-c2c1sc(N)c2C#N |
| InChI | InChI=1S/C15H6N4S/c16-5-8(6-17)12-9-3-1-2-4-10(9)13-11(7-18)15(19)20-14(12)13/h1-4H,19H2 |
| InChIKey | FXRRYNYEENNVKN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|