C42H14N10S — CID 134386098
2-[6,16-bis(4-cyanoquinazolin-2-yl)-13-(dicyanomethylidene)-11-thiapentacyclo[10.7.0.02,10.03,8.014,19]nonadeca-1(12),2(10),3(8),4,6,14(19),15,17-octaen-9-ylidene]propanedinitrile (PubChem CID 134386098) has the molecular formula C42H14N10S and a molecular weight of 690.71 g/mol. Its IUPAC name is 2-[6,16-bis(4-cyanoquinazolin-2-yl)-13-(dicyanomethylidene)-11-thiapentacyclo[10.7.0.02,10.03,8.014,19]nonadeca-1(12),2(10),3(8),4,6,14(19),15,17-octaen-9-ylidene]propanedinitrile.
| Compound Name | 2-[6,16-bis(4-cyanoquinazolin-2-yl)-13-(dicyanomethylidene)-11-thiapentacyclo[10.7.0.02,10.03,8.014,19]nonadeca-1(12),2(10),3(8),4,6,14(19),15,17-octaen-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 134386098 |
| Molecular Formula | C42H14N10S |
| Molecular Weight | 690.71 g/mol |
| Exact Mass | 690.11 |
| IUPAC Name | 2-[6,16-bis(4-cyanoquinazolin-2-yl)-13-(dicyanomethylidene)-11-thiapentacyclo[10.7.0.02,10.03,8.014,19]nonadeca-1(12),2(10),3(8),4,6,14(19),15,17-octaen-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(-c3nc(C#N)c4ccccc4n3)ccc2-c2c1sc1c2-c2ccc(-c3nc(C#N)c4ccccc4n3)cc2C1=C(C#N)C#N |
| InChI | InChI=1S/C42H14N10S/c43-15-23(16-44)35-29-13-21(41-49-31-7-3-1-5-27(31)33(19-47)51-41)9-11-25(29)37-38-26-12-10-22(42-50-32-8-4-2-6-28(32)34(20-48)52-42)14-30(26)36(24(17-45)18-46)40(38)53-39(35)37/h1-14H |
| InChIKey | KXDDPDRTVGSUKB-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 194.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.71 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|