C53H33N5 — CID 170215168
2-[3,4-bis[3-(2-phenylquinazolin-4-yl)phenyl]phenyl]benzonitrile (PubChem CID 170215168) has the molecular formula C53H33N5 and a molecular weight of 739.88 g/mol. Its IUPAC name is 2-[3,4-bis[3-(2-phenylquinazolin-4-yl)phenyl]phenyl]benzonitrile.
| Compound Name | 2-[3,4-bis[3-(2-phenylquinazolin-4-yl)phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 170215168 |
| Molecular Formula | C53H33N5 |
| Molecular Weight | 739.88 g/mol |
| Exact Mass | 739.27 |
| IUPAC Name | 2-[3,4-bis[3-(2-phenylquinazolin-4-yl)phenyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccc(-c2cccc(-c3nc(-c4ccccc4)nc4ccccc34)c2)c(-c2cccc(-c3nc(-c4ccccc4)nc4ccccc34)c2)c1 |
| InChI | InChI=1S/C53H33N5/c54-34-42-19-7-8-24-43(42)39-29-30-44(37-20-13-22-40(31-37)50-45-25-9-11-27-48(45)55-52(57-50)35-15-3-1-4-16-35)47(33-39)38-21-14-23-41(32-38)51-46-26-10-12-28-49(46)56-53(58-51)36-17-5-2-6-18-36/h1-33H |
| InChIKey | IEDOKFPKIDFDAQ-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.88 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |