C61H39N7 — CID 170215378
2-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-[2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]benzonitrile (PubChem CID 170215378) has the molecular formula C61H39N7 and a molecular weight of 870.03 g/mol. Its IUPAC name is 2-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-[2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-[2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 170215378 |
| Molecular Formula | C61H39N7 |
| Molecular Weight | 870.03 g/mol |
| Exact Mass | 869.33 |
| IUPAC Name | 2-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-[2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c(-c2ccccc2-c2ccccc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C61H39N7/c62-40-48-28-13-14-31-49(48)46-36-37-50(45-29-19-30-47(38-45)60-65-56(41-20-5-1-6-21-41)63-57(66-60)42-22-7-2-8-23-42)55(39-46)53-34-16-15-32-51(53)52-33-17-18-35-54(52)61-67-58(43-24-9-3-10-25-43)64-59(68-61)44-26-11-4-12-27-44/h1-39H |
| InChIKey | JIUAIULRZFSRSD-UHFFFAOYSA-N |
| XLogP | 14.60 |
| TPSA | 101.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.03 |
| LogP ≤ 5 | 14.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |