C47H29N5 — CID 169297045
3,4-bis[3-(2-phenylquinazolin-4-yl)phenyl]benzonitrile (PubChem CID 169297045) has the molecular formula C47H29N5 and a molecular weight of 663.78 g/mol. Its IUPAC name is 3,4-bis[3-(2-phenylquinazolin-4-yl)phenyl]benzonitrile.
| Compound Name | 3,4-bis[3-(2-phenylquinazolin-4-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 169297045 |
| Molecular Formula | C47H29N5 |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 663.24 |
| IUPAC Name | 3,4-bis[3-(2-phenylquinazolin-4-yl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cccc(-c3nc(-c4ccccc4)nc4ccccc34)c2)c(-c2cccc(-c3nc(-c4ccccc4)nc4ccccc34)c2)c1 |
| InChI | InChI=1S/C47H29N5/c48-30-31-25-26-38(34-17-11-19-36(28-34)44-39-21-7-9-23-42(39)49-46(51-44)32-13-3-1-4-14-32)41(27-31)35-18-12-20-37(29-35)45-40-22-8-10-24-43(40)50-47(52-45)33-15-5-2-6-16-33/h1-29H |
| InChIKey | GONVEMVDSDLHGC-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |