C8N2O4 — CID 140976357
3,4,5,6-tetraoxocyclohexene-1,2-dicarbonitrile (PubChem CID 140976357) has the molecular formula C8N2O4 and a molecular weight of 188.10 g/mol. Its IUPAC name is 3,4,5,6-tetraoxocyclohexene-1,2-dicarbonitrile.
| Compound Name | 3,4,5,6-tetraoxocyclohexene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 140976357 |
| Molecular Formula | C8N2O4 |
| Molecular Weight | 188.10 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | 3,4,5,6-tetraoxocyclohexene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c(=O)c(=O)c(=O)c1=O |
| InChI | InChI=1S/C8N2O4/c9-1-3-4(2-10)6(12)8(14)7(13)5(3)11 |
| InChIKey | LCQSJZTZFLUYJR-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 115.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.10 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|