C26H12N2O2 — CID 129184944
3,5-dioxo-2,6-diphenyl-s-indacene-1,7-dicarbonitrile (PubChem CID 129184944) has the molecular formula C26H12N2O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is 3,5-dioxo-2,6-diphenyl-s-indacene-1,7-dicarbonitrile.
| Compound Name | 3,5-dioxo-2,6-diphenyl-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 129184944 |
| Molecular Formula | C26H12N2O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 3,5-dioxo-2,6-diphenyl-s-indacene-1,7-dicarbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)c(=O)c2cc3c(=O)c(-c4ccccc4)c(C#N)c3cc12 |
| InChI | InChI=1S/C26H12N2O2/c27-13-21-17-11-18-20(12-19(17)25(29)23(21)15-7-3-1-4-8-15)26(30)24(22(18)14-28)16-9-5-2-6-10-16/h1-12H |
| InChIKey | UCPMCOZDCIXZFU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |