C21H11N5O3 — CID 11794207
13-amino-2,9,17-trioxo-15-phenyl-1,10,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaene-14-carbonitrile (PubChem CID 11794207) has the molecular formula C21H11N5O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is 13-amino-2,9,17-trioxo-15-phenyl-1,10,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaene-14-carbonitrile.
| Compound Name | 13-amino-2,9,17-trioxo-15-phenyl-1,10,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaene-14-carbonitrile |
|---|---|
| PubChem CID | 11794207 |
| Molecular Formula | C21H11N5O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 13-amino-2,9,17-trioxo-15-phenyl-1,10,12-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,11(16),12,14-hexaene-14-carbonitrile |
| SMILES | N#Cc1c(N)nc2c(c1-c1ccccc1)c(=O)n1c(=O)c3ccccc3c(=O)n21 |
| InChI | InChI=1S/C21H11N5O3/c22-10-14-15(11-6-2-1-3-7-11)16-18(24-17(14)23)25-19(27)12-8-4-5-9-13(12)20(28)26(25)21(16)29/h1-9H,(H2,23,24) |
| InChIKey | JDPTWJWRYNMMGH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |