C18H15N3O2 — CID 70227227
2-amino-5,6-dimethoxy-4-phenylquinoline-3-carbonitrile (PubChem CID 70227227) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-amino-5,6-dimethoxy-4-phenylquinoline-3-carbonitrile.
| Compound Name | 2-amino-5,6-dimethoxy-4-phenylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 70227227 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-amino-5,6-dimethoxy-4-phenylquinoline-3-carbonitrile |
| SMILES | COc1ccc2nc(N)c(C#N)c(-c3ccccc3)c2c1OC |
| InChI | InChI=1S/C18H15N3O2/c1-22-14-9-8-13-16(17(14)23-2)15(11-6-4-3-5-7-11)12(10-19)18(20)21-13/h3-9H,1-2H3,(H2,20,21) |
| InChIKey | JMGXVTSVZWGKHU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |