C17H13N3 — CID 123813624
2-amino-6-methyl-3-phenylquinoline-4-carbonitrile (PubChem CID 123813624) has the molecular formula C17H13N3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-amino-6-methyl-3-phenylquinoline-4-carbonitrile.
| Compound Name | 2-amino-6-methyl-3-phenylquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 123813624 |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-amino-6-methyl-3-phenylquinoline-4-carbonitrile |
| SMILES | Cc1ccc2nc(N)c(-c3ccccc3)c(C#N)c2c1 |
| InChI | InChI=1S/C17H13N3/c1-11-7-8-15-13(9-11)14(10-18)16(17(19)20-15)12-5-3-2-4-6-12/h2-9H,1H3,(H2,19,20) |
| InChIKey | UHUVFSKRIJOOSZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |